C21H11Cl2N3O5 — CID 126091848
(Z)-3-[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]-2-phenylprop-2-enenitrile (PubChem CID 126091848) has the molecular formula C21H11Cl2N3O5 and a molecular weight of 456.24 g/mol. Its IUPAC name is (Z)-3-[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]-2-phenylprop-2-enenitrile.
| Compound Name | (Z)-3-[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 126091848 |
| Molecular Formula | C21H11Cl2N3O5 |
| Molecular Weight | 456.24 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | (Z)-3-[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]-2-phenylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Cl)cc(Cl)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C21H11Cl2N3O5/c22-16-9-14(8-15(12-24)13-4-2-1-3-5-13)21(18(23)10-16)31-20-7-6-17(25(27)28)11-19(20)26(29)30/h1-11H/b15-8+ |
| InChIKey | ZBYDSVMEVFISQJ-OVCLIPMQSA-N |
| XLogP | 6.67 |
| TPSA | 119.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.24 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|