C24H16Cl2N4O6 — CID 126093722
(E)-2-cyano-3-[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 126093722) has the molecular formula C24H16Cl2N4O6 and a molecular weight of 527.32 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126093722 |
| Molecular Formula | C24H16Cl2N4O6 |
| Molecular Weight | 527.32 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C/c2cc(Cl)cc(Cl)c2Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C24H16Cl2N4O6/c1-13-3-5-20(14(2)7-13)28-24(31)16(12-27)8-15-9-17(25)10-19(26)23(15)36-22-6-4-18(29(32)33)11-21(22)30(34)35/h3-11H,1-2H3,(H,28,31)/b16-8+ |
| InChIKey | CGPLFAQNDPGYBA-LZYBPNLTSA-N |
| XLogP | 6.76 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.32 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|