C18H14N3O4- — CID 6957260
4-[(E)-2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2-nitrophenolate (PubChem CID 6957260) has the molecular formula C18H14N3O4- and a molecular weight of 336.33 g/mol. Its IUPAC name is 4-[(E)-2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2-nitrophenolate.
| Compound Name | 4-[(E)-2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 6957260 |
| Molecular Formula | C18H14N3O4- |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-[(E)-2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2-nitrophenolate |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C/c2ccc([O-])c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C18H15N3O4/c1-11-3-5-15(12(2)7-11)20-18(23)14(10-19)8-13-4-6-17(22)16(9-13)21(24)25/h3-9,22H,1-2H3,(H,20,23)/p-1/b14-8+ |
| InChIKey | FJCTURFOOXVAIU-RIYZIHGNSA-M |
| XLogP | 2.83 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|