C25H27N3O — CID 50864403
(E)-2-cyano-N-(2,4-dimethylphenyl)-3-(1,2,2,4-tetramethylquinolin-6-yl)prop-2-enamide (PubChem CID 50864403) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,4-dimethylphenyl)-3-(1,2,2,4-tetramethylquinolin-6-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,4-dimethylphenyl)-3-(1,2,2,4-tetramethylquinolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 50864403 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | (E)-2-cyano-N-(2,4-dimethylphenyl)-3-(1,2,2,4-tetramethylquinolin-6-yl)prop-2-enamide |
| SMILES | CC1=CC(C)(C)N(C)c2ccc(/C=C(\C#N)C(=O)Nc3ccc(C)cc3C)cc21 |
| InChI | InChI=1S/C25H27N3O/c1-16-7-9-22(17(2)11-16)27-24(29)20(15-26)12-19-8-10-23-21(13-19)18(3)14-25(4,5)28(23)6/h7-14H,1-6H3,(H,27,29)/b20-12+ |
| InChIKey | KOXBJIQWXFNJFV-UDWIEESQSA-N |
| XLogP | 5.48 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|