C27H31N3O — CID 50868103
(E)-2-cyano-N-(3,5-dimethylphenyl)-3-(2,2,4-trimethyl-1-propylquinolin-6-yl)prop-2-enamide (PubChem CID 50868103) has the molecular formula C27H31N3O and a molecular weight of 413.57 g/mol. Its IUPAC name is (E)-2-cyano-N-(3,5-dimethylphenyl)-3-(2,2,4-trimethyl-1-propylquinolin-6-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3,5-dimethylphenyl)-3-(2,2,4-trimethyl-1-propylquinolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 50868103 |
| Molecular Formula | C27H31N3O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | (E)-2-cyano-N-(3,5-dimethylphenyl)-3-(2,2,4-trimethyl-1-propylquinolin-6-yl)prop-2-enamide |
| SMILES | CCCN1c2ccc(/C=C(\C#N)C(=O)Nc3cc(C)cc(C)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C27H31N3O/c1-7-10-30-25-9-8-21(15-24(25)20(4)16-27(30,5)6)14-22(17-28)26(31)29-23-12-18(2)11-19(3)13-23/h8-9,11-16H,7,10H2,1-6H3,(H,29,31)/b22-14+ |
| InChIKey | VURSBXXQZYAIGN-HYARGMPZSA-N |
| XLogP | 6.26 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|