C25H26FN3O — CID 50869443
(E)-2-cyano-3-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)-N-phenylprop-2-enamide (PubChem CID 50869443) has the molecular formula C25H26FN3O and a molecular weight of 403.50 g/mol. Its IUPAC name is (E)-2-cyano-3-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)-N-phenylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 50869443 |
| Molecular Formula | C25H26FN3O |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (E)-2-cyano-3-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)-N-phenylprop-2-enamide |
| SMILES | CCCN1c2cc(F)c(/C=C(\C#N)C(=O)Nc3ccccc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C25H26FN3O/c1-5-11-29-23-14-22(26)18(13-21(23)17(2)15-25(29,3)4)12-19(16-27)24(30)28-20-9-7-6-8-10-20/h6-10,12-15H,5,11H2,1-4H3,(H,28,30)/b19-12+ |
| InChIKey | ORWNDGLNMRKBHR-XDHOZWIPSA-N |
| XLogP | 5.78 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|