C26H28ClN3O2 — CID 50869704
(E)-N-(3-chlorophenyl)-2-cyano-3-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)prop-2-enamide (PubChem CID 50869704) has the molecular formula C26H28ClN3O2 and a molecular weight of 449.98 g/mol. Its IUPAC name is (E)-N-(3-chlorophenyl)-2-cyano-3-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)prop-2-enamide.
| Compound Name | (E)-N-(3-chlorophenyl)-2-cyano-3-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 50869704 |
| Molecular Formula | C26H28ClN3O2 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (E)-N-(3-chlorophenyl)-2-cyano-3-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)prop-2-enamide |
| SMILES | CCCN1c2cc(OC)c(/C=C(\C#N)C(=O)Nc3cccc(Cl)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C26H28ClN3O2/c1-6-10-30-23-14-24(32-5)18(12-22(23)17(2)15-26(30,3)4)11-19(16-28)25(31)29-21-9-7-8-20(27)13-21/h7-9,11-15H,6,10H2,1-5H3,(H,29,31)/b19-11+ |
| InChIKey | SHDPFVGDEQZUNA-YBFXNURJSA-N |
| XLogP | 6.31 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|