C26H29N3O2 — CID 50867714
(E)-N-benzyl-2-cyano-3-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)prop-2-enamide (PubChem CID 50867714) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is (E)-N-benzyl-2-cyano-3-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)prop-2-enamide.
| Compound Name | (E)-N-benzyl-2-cyano-3-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 50867714 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | (E)-N-benzyl-2-cyano-3-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)prop-2-enamide |
| SMILES | CCN1c2cc(OC)c(/C=C(\C#N)C(=O)NCc3ccccc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C26H29N3O2/c1-6-29-23-14-24(31-5)20(13-22(23)18(2)15-26(29,3)4)12-21(16-27)25(30)28-17-19-10-8-7-9-11-19/h7-15H,6,17H2,1-5H3,(H,28,30)/b21-12+ |
| InChIKey | NJICYSJOHZSTOF-CIAFOILYSA-N |
| XLogP | 4.94 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|