C25H25Cl2N3O — CID 50867267
(E)-3-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide (PubChem CID 50867267) has the molecular formula C25H25Cl2N3O and a molecular weight of 454.40 g/mol. Its IUPAC name is (E)-3-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 50867267 |
| Molecular Formula | C25H25Cl2N3O |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (E)-3-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)-N-(3-chloro-2-methylphenyl)-2-cyanoprop-2-enamide |
| SMILES | CCN1c2cc(Cl)c(/C=C(\C#N)C(=O)Nc3cccc(Cl)c3C)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C25H25Cl2N3O/c1-6-30-23-12-21(27)17(11-19(23)15(2)13-25(30,4)5)10-18(14-28)24(31)29-22-9-7-8-20(26)16(22)3/h7-13H,6H2,1-5H3,(H,29,31)/b18-10+ |
| InChIKey | JLDOPSXZWBACCW-VCHYOVAHSA-N |
| XLogP | 6.87 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|