C24H25Cl2N3O — CID 99886310
(Z)-N-(3-chloro-2-methylphenyl)-3-[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]-2-cyanoprop-2-enamide (PubChem CID 99886310) has the molecular formula C24H25Cl2N3O and a molecular weight of 442.39 g/mol. Its IUPAC name is (Z)-N-(3-chloro-2-methylphenyl)-3-[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(3-chloro-2-methylphenyl)-3-[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 99886310 |
| Molecular Formula | C24H25Cl2N3O |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (Z)-N-(3-chloro-2-methylphenyl)-3-[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]-2-cyanoprop-2-enamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)/C(C#N)=C\c1cc2c(cc1Cl)N(C)C(C)(C)C[C@@H]2C |
| InChI | InChI=1S/C24H25Cl2N3O/c1-14-12-24(3,4)29(5)22-11-20(26)16(10-18(14)22)9-17(13-27)23(30)28-21-8-6-7-19(25)15(21)2/h6-11,14H,12H2,1-5H3,(H,28,30)/b17-9-/t14-/m0/s1 |
| InChIKey | YHTFJFYHEMUZBL-DUPVFGOHSA-N |
| XLogP | 6.57 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|