C26H31N3O — CID 50858782
(E)-2-cyano-N-(3,5-dimethylphenyl)-3-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)prop-2-enamide (PubChem CID 50858782) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is (E)-2-cyano-N-(3,5-dimethylphenyl)-3-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3,5-dimethylphenyl)-3-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 50858782 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | (E)-2-cyano-N-(3,5-dimethylphenyl)-3-(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)prop-2-enamide |
| SMILES | Cc1cc(C)cc(NC(=O)/C(C#N)=C/c2cc3c(cc2C)N(C)C(C)(C)CC3C)c1 |
| InChI | InChI=1S/C26H31N3O/c1-16-8-17(2)10-22(9-16)28-25(30)21(15-27)12-20-13-23-19(4)14-26(5,6)29(7)24(23)11-18(20)3/h8-13,19H,14H2,1-7H3,(H,28,30)/b21-12+ |
| InChIKey | ALEIENIGROUISK-CIAFOILYSA-N |
| XLogP | 5.88 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|