C24H26BrN3O2 — CID 50859742
(E)-N-(3-bromophenyl)-2-cyano-3-(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)prop-2-enamide (PubChem CID 50859742) has the molecular formula C24H26BrN3O2 and a molecular weight of 468.40 g/mol. Its IUPAC name is (E)-N-(3-bromophenyl)-2-cyano-3-(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)prop-2-enamide.
| Compound Name | (E)-N-(3-bromophenyl)-2-cyano-3-(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 50859742 |
| Molecular Formula | C24H26BrN3O2 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (E)-N-(3-bromophenyl)-2-cyano-3-(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)prop-2-enamide |
| SMILES | COc1cc2c(cc1/C=C(\C#N)C(=O)Nc1cccc(Br)c1)C(C)CC(C)(C)N2C |
| InChI | InChI=1S/C24H26BrN3O2/c1-15-13-24(2,3)28(4)21-12-22(30-5)16(10-20(15)21)9-17(14-26)23(29)27-19-8-6-7-18(25)11-19/h6-12,15H,13H2,1-5H3,(H,27,29)/b17-9+ |
| InChIKey | OHSNENHABNREPA-RQZCQDPDSA-N |
| XLogP | 5.73 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|