C23H25BrN2O — CID 50859770
(Z)-2-(3-bromophenyl)-3-(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)prop-2-enenitrile (PubChem CID 50859770) has the molecular formula C23H25BrN2O and a molecular weight of 425.37 g/mol. Its IUPAC name is (Z)-2-(3-bromophenyl)-3-(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(3-bromophenyl)-3-(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 50859770 |
| Molecular Formula | C23H25BrN2O |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | (Z)-2-(3-bromophenyl)-3-(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)prop-2-enenitrile |
| SMILES | COc1cc2c(cc1/C=C(\C#N)c1cccc(Br)c1)C(C)CC(C)(C)N2C |
| InChI | InChI=1S/C23H25BrN2O/c1-15-13-23(2,3)26(4)21-12-22(27-5)17(11-20(15)21)9-18(14-25)16-7-6-8-19(24)10-16/h6-12,15H,13H2,1-5H3/b18-9+ |
| InChIKey | NCEYQPUSPSZJLG-GIJQJNRQSA-N |
| XLogP | 6.24 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|