C23H25ClN2 — CID 99885776
(E)-2-(3-chlorophenyl)-3-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]prop-2-enenitrile (PubChem CID 99885776) has the molecular formula C23H25ClN2 and a molecular weight of 364.92 g/mol. Its IUPAC name is (E)-2-(3-chlorophenyl)-3-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(3-chlorophenyl)-3-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 99885776 |
| Molecular Formula | C23H25ClN2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (E)-2-(3-chlorophenyl)-3-[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]prop-2-enenitrile |
| SMILES | Cc1cc2c(cc1/C=C(/C#N)c1cccc(Cl)c1)[C@@H](C)CC(C)(C)N2C |
| InChI | InChI=1S/C23H25ClN2/c1-15-9-22-21(16(2)13-23(3,4)26(22)5)12-18(15)10-19(14-25)17-7-6-8-20(24)11-17/h6-12,16H,13H2,1-5H3/b19-10-/t16-/m0/s1 |
| InChIKey | JCIDFIRTQNBYST-WSLMLHKMSA-N |
| XLogP | 6.43 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|