C24H26ClN3O — CID 132663087
(Z)-3-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)-2-cyano-N-(3-methylphenyl)prop-2-enamide (PubChem CID 132663087) has the molecular formula C24H26ClN3O and a molecular weight of 407.95 g/mol. Its IUPAC name is (Z)-3-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)-2-cyano-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)-2-cyano-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 132663087 |
| Molecular Formula | C24H26ClN3O |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (Z)-3-(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)-2-cyano-N-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C\c2cc3c(cc2Cl)N(C)C(C)(C)CC3C)c1 |
| InChI | InChI=1S/C24H26ClN3O/c1-15-7-6-8-19(9-15)27-23(29)18(14-26)10-17-11-20-16(2)13-24(3,4)28(5)22(20)12-21(17)25/h6-12,16H,13H2,1-5H3,(H,27,29)/b18-10- |
| InChIKey | CPRTTXJCTGTVES-ZDLGFXPLSA-N |
| XLogP | 5.92 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|