C24H24ClN3O — CID 99887780
(Z)-3-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-2-cyano-N-(3-methylphenyl)prop-2-enamide (PubChem CID 99887780) has the molecular formula C24H24ClN3O and a molecular weight of 405.93 g/mol. Its IUPAC name is (Z)-3-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-2-cyano-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-2-cyano-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 99887780 |
| Molecular Formula | C24H24ClN3O |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (Z)-3-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-2-cyano-N-(3-methylphenyl)prop-2-enamide |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c(/C=C(/C#N)C(=O)Nc3cccc(C)c3)cc21 |
| InChI | InChI=1S/C24H24ClN3O/c1-15-7-6-8-19(9-15)27-23(29)18(14-26)10-17-11-20-16(2)13-24(3,4)28(5)22(20)12-21(17)25/h6-13H,1-5H3,(H,27,29)/b18-10- |
| InChIKey | DXLNNBJRGYDVDS-ZDLGFXPLSA-N |
| XLogP | 5.83 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|