C25H27F3N2 — CID 50860428
(Z)-3-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)-2-[4-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 50860428) has the molecular formula C25H27F3N2 and a molecular weight of 412.50 g/mol. Its IUPAC name is (Z)-3-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)-2-[4-(trifluoromethyl)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)-2-[4-(trifluoromethyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 50860428 |
| Molecular Formula | C25H27F3N2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (Z)-3-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)-2-[4-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | CCN1c2cc(C)c(/C=C(\C#N)c3ccc(C(F)(F)F)cc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C25H27F3N2/c1-6-30-23-11-16(2)19(13-22(23)17(3)14-24(30,4)5)12-20(15-29)18-7-9-21(10-8-18)25(26,27)28/h7-13,17H,6,14H2,1-5H3/b20-12+ |
| InChIKey | CCZRUBAOFCVRCS-UDWIEESQSA-N |
| XLogP | 7.19 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|