C26H27F3N2 — CID 50868746
(Z)-3-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)-2-[4-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 50868746) has the molecular formula C26H27F3N2 and a molecular weight of 424.51 g/mol. Its IUPAC name is (Z)-3-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)-2-[4-(trifluoromethyl)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)-2-[4-(trifluoromethyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 50868746 |
| Molecular Formula | C26H27F3N2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (Z)-3-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)-2-[4-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | CCCN1c2cc(C)c(/C=C(\C#N)c3ccc(C(F)(F)F)cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C26H27F3N2/c1-6-11-31-24-12-17(2)20(14-23(24)18(3)15-25(31,4)5)13-21(16-30)19-7-9-22(10-8-19)26(27,28)29/h7-10,12-15H,6,11H2,1-5H3/b21-13+ |
| InChIKey | NAGLFRVZYOBQFB-FYJGNVAPSA-N |
| XLogP | 7.49 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|