C25H30N2O2 — CID 50868976
3-methyl-4-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzoic acid (PubChem CID 50868976) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 3-methyl-4-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzoic acid.
| Compound Name | 3-methyl-4-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 50868976 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 3-methyl-4-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzoic acid |
| SMILES | CCCN1c2cc(C)c(/C=N/c3ccc(C(=O)O)cc3C)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C25H30N2O2/c1-7-10-27-23-12-16(2)20(13-21(23)18(4)14-25(27,5)6)15-26-22-9-8-19(24(28)29)11-17(22)3/h8-9,11-15H,7,10H2,1-6H3,(H,28,29)/b26-15+ |
| InChIKey | PNHSPJGZXXPZBK-CVKSISIWSA-N |
| XLogP | 6.16 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|