C24H28N2O2 — CID 50868445
4-methyl-3-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzoic acid (PubChem CID 50868445) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-methyl-3-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzoic acid.
| Compound Name | 4-methyl-3-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 50868445 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 4-methyl-3-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzoic acid |
| SMILES | CCCN1c2ccc(/C=N/c3cc(C(=O)O)ccc3C)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H28N2O2/c1-6-11-26-22-10-8-18(12-20(22)17(3)14-24(26,4)5)15-25-21-13-19(23(27)28)9-7-16(21)2/h7-10,12-15H,6,11H2,1-5H3,(H,27,28)/b25-15+ |
| InChIKey | FZGAWSFEWMIIJB-MFKUBSTISA-N |
| XLogP | 5.86 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|