C24H31N5OS — CID 50868121
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]acetamide (PubChem CID 50868121) has the molecular formula C24H31N5OS and a molecular weight of 437.61 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]acetamide.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 50868121 |
| Molecular Formula | C24H31N5OS |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]acetamide |
| SMILES | CCCN1c2ccc(/C=N\NC(=O)CSc3nc(C)cc(C)n3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H31N5OS/c1-7-10-29-21-9-8-19(12-20(21)16(2)13-24(29,5)6)14-25-28-22(30)15-31-23-26-17(3)11-18(4)27-23/h8-9,11-14H,7,10,15H2,1-6H3,(H,28,30)/b25-14- |
| InChIKey | SSLYXPYGCHLDCL-QFEZKATASA-N |
| XLogP | 4.75 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|