C24H31N5O2S — CID 50867785
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]acetamide (PubChem CID 50867785) has the molecular formula C24H31N5O2S and a molecular weight of 453.61 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]acetamide.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 50867785 |
| Molecular Formula | C24H31N5O2S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]acetamide |
| SMILES | CCN1c2cc(OC)c(/C=N\NC(=O)CSc3nc(C)cc(C)n3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H31N5O2S/c1-8-29-20-11-21(31-7)18(10-19(20)15(2)12-24(29,5)6)13-25-28-22(30)14-32-23-26-16(3)9-17(4)27-23/h9-13H,8,14H2,1-7H3,(H,28,30)/b25-13- |
| InChIKey | OBVJAAXDAJYBBC-MXAYSNPKSA-N |
| XLogP | 4.37 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|