C24H28N2O3 — CID 50867799
methyl 3-[(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]benzoate (PubChem CID 50867799) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is methyl 3-[(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]benzoate.
| Compound Name | methyl 3-[(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 50867799 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | methyl 3-[(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]benzoate |
| SMILES | CCN1c2cc(OC)c(/C=N/c3cccc(C(=O)OC)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H28N2O3/c1-7-26-21-13-22(28-5)18(12-20(21)16(2)14-24(26,3)4)15-25-19-10-8-9-17(11-19)23(27)29-6/h8-15H,7H2,1-6H3/b25-15+ |
| InChIKey | XJIFQWWGKJPGJS-MFKUBSTISA-N |
| XLogP | 5.25 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|