C22H24ClFN2O — CID 50868209
N-(3-chloro-4-fluorophenyl)-1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methanimine (PubChem CID 50868209) has the molecular formula C22H24ClFN2O and a molecular weight of 386.90 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methanimine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50868209 |
| Molecular Formula | C22H24ClFN2O |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methanimine |
| SMILES | CCN1c2cc(OC)c(/C=N/c3ccc(F)c(Cl)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C22H24ClFN2O/c1-6-26-20-11-21(27-5)15(9-17(20)14(2)12-22(26,3)4)13-25-16-7-8-19(24)18(23)10-16/h7-13H,6H2,1-5H3/b25-13+ |
| InChIKey | JVFZEJMWROAUOR-DHRITJCHSA-N |
| XLogP | 6.26 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|