C26H35N3O — CID 50868304
N,N-diethyl-4-[(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]aniline (PubChem CID 50868304) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is N,N-diethyl-4-[(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]aniline.
| Compound Name | N,N-diethyl-4-[(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 50868304 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | N,N-diethyl-4-[(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]aniline |
| SMILES | CCN(CC)c1ccc(/N=C/c2cc3c(cc2OC)N(CC)C(C)(C)C=C3C)cc1 |
| InChI | InChI=1S/C26H35N3O/c1-8-28(9-2)22-13-11-21(12-14-22)27-18-20-15-23-19(4)17-26(5,6)29(10-3)24(23)16-25(20)30-7/h11-18H,8-10H2,1-7H3/b27-18+ |
| InChIKey | FFDXMAXZWVTREC-OVVQPSECSA-N |
| XLogP | 6.31 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|