C23H28N2O2 — CID 50867716
1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)-N-(4-methoxyphenyl)methanimine (PubChem CID 50867716) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)-N-(4-methoxyphenyl)methanimine.
| Compound Name | 1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)-N-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 50867716 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)-N-(4-methoxyphenyl)methanimine |
| SMILES | CCN1c2cc(OC)c(/C=N/c3ccc(OC)cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H28N2O2/c1-7-25-21-13-22(27-6)17(12-20(21)16(2)14-23(25,3)4)15-24-18-8-10-19(26-5)11-9-18/h8-15H,7H2,1-6H3/b24-15+ |
| InChIKey | SYDSCWWZZGQMGX-BUVRLJJBSA-N |
| XLogP | 5.48 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|