C30H34N2O2 — CID 50869837
1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)-N-[4-(2-methylphenoxy)phenyl]methanimine (PubChem CID 50869837) has the molecular formula C30H34N2O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is 1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)-N-[4-(2-methylphenoxy)phenyl]methanimine.
| Compound Name | 1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)-N-[4-(2-methylphenoxy)phenyl]methanimine |
|---|---|
| PubChem CID | 50869837 |
| Molecular Formula | C30H34N2O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)-N-[4-(2-methylphenoxy)phenyl]methanimine |
| SMILES | CCCN1c2cc(OC)c(/C=N/c3ccc(Oc4ccccc4C)cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C30H34N2O2/c1-7-16-32-27-18-29(33-6)23(17-26(27)22(3)19-30(32,4)5)20-31-24-12-14-25(15-13-24)34-28-11-9-8-10-21(28)2/h8-15,17-20H,7,16H2,1-6H3/b31-20+ |
| InChIKey | HYOJPUXOYVNOEO-AJBULDERSA-N |
| XLogP | 7.96 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|