C27H30N2 — CID 50869022
N-naphthalen-2-yl-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine (PubChem CID 50869022) has the molecular formula C27H30N2 and a molecular weight of 382.55 g/mol. Its IUPAC name is N-naphthalen-2-yl-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine.
| Compound Name | N-naphthalen-2-yl-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50869022 |
| Molecular Formula | C27H30N2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-naphthalen-2-yl-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine |
| SMILES | CCCN1c2cc(C)c(/C=N/c3ccc4ccccc4c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C27H30N2/c1-6-13-29-26-14-19(2)23(16-25(26)20(3)17-27(29,4)5)18-28-24-12-11-21-9-7-8-10-22(21)15-24/h7-12,14-18H,6,13H2,1-5H3/b28-18+ |
| InChIKey | OBKPRYCERCNCBE-MTDXEUNCSA-N |
| XLogP | 7.31 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|