C29H33N3 — CID 50868952
N-phenyl-4-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]aniline (PubChem CID 50868952) has the molecular formula C29H33N3 and a molecular weight of 423.60 g/mol. Its IUPAC name is N-phenyl-4-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]aniline.
| Compound Name | N-phenyl-4-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 50868952 |
| Molecular Formula | C29H33N3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | N-phenyl-4-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]aniline |
| SMILES | CCCN1c2cc(C)c(/C=N/c3ccc(Nc4ccccc4)cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C29H33N3/c1-6-16-32-28-17-21(2)23(18-27(28)22(3)19-29(32,4)5)20-30-24-12-14-26(15-13-24)31-25-10-8-7-9-11-25/h7-15,17-20,31H,6,16H2,1-5H3/b30-20+ |
| InChIKey | IUIPJCBYQSIURN-TWKHWXDSSA-N |
| XLogP | 7.90 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|