C30H34N2O — CID 50868575
N-[4-(4-methylphenoxy)phenyl]-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine (PubChem CID 50868575) has the molecular formula C30H34N2O and a molecular weight of 438.62 g/mol. Its IUPAC name is N-[4-(4-methylphenoxy)phenyl]-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine.
| Compound Name | N-[4-(4-methylphenoxy)phenyl]-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50868575 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | N-[4-(4-methylphenoxy)phenyl]-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine |
| SMILES | CCCN1c2cc(C)c(/C=N/c3ccc(Oc4ccc(C)cc4)cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C30H34N2O/c1-7-16-32-29-17-22(3)24(18-28(29)23(4)19-30(32,5)6)20-31-25-10-14-27(15-11-25)33-26-12-8-21(2)9-13-26/h8-15,17-20H,7,16H2,1-6H3/b31-20+ |
| InChIKey | UCZXKIZMICTKCM-AJBULDERSA-N |
| XLogP | 8.26 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|