C24H29FN2 — CID 50868999
N-(4-fluoro-3-methylphenyl)-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine (PubChem CID 50868999) has the molecular formula C24H29FN2 and a molecular weight of 364.51 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine.
| Compound Name | N-(4-fluoro-3-methylphenyl)-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50868999 |
| Molecular Formula | C24H29FN2 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine |
| SMILES | CCCN1c2cc(C)c(/C=N/c3ccc(F)c(C)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H29FN2/c1-7-10-27-23-12-16(2)19(13-21(23)18(4)14-24(27,5)6)15-26-20-8-9-22(25)17(3)11-20/h8-9,11-15H,7,10H2,1-6H3/b26-15+ |
| InChIKey | GUHXBKCPYBWRPC-CVKSISIWSA-N |
| XLogP | 6.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|