C23H27N3O2 — CID 50868677
N-(4-nitrophenyl)-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine (PubChem CID 50868677) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-(4-nitrophenyl)-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine.
| Compound Name | N-(4-nitrophenyl)-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50868677 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-(4-nitrophenyl)-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine |
| SMILES | CCCN1c2cc(C)c(/C=N/c3ccc([N+](=O)[O-])cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H27N3O2/c1-6-11-25-22-12-16(2)18(13-21(22)17(3)14-23(25,4)5)15-24-19-7-9-20(10-8-19)26(27)28/h7-10,12-15H,6,11H2,1-5H3/b24-15+ |
| InChIKey | WFTTUUGMKKHRRA-BUVRLJJBSA-N |
| XLogP | 6.07 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|