C23H27FN2 — CID 50869014
N-(2-fluorophenyl)-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine (PubChem CID 50869014) has the molecular formula C23H27FN2 and a molecular weight of 350.48 g/mol. Its IUPAC name is N-(2-fluorophenyl)-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine.
| Compound Name | N-(2-fluorophenyl)-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50869014 |
| Molecular Formula | C23H27FN2 |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N-(2-fluorophenyl)-1-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methanimine |
| SMILES | CCCN1c2cc(C)c(/C=N/c3ccccc3F)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H27FN2/c1-6-11-26-22-12-16(2)18(13-19(22)17(3)14-23(26,4)5)15-25-21-10-8-7-9-20(21)24/h7-10,12-15H,6,11H2,1-5H3/b25-15+ |
| InChIKey | PHAMDCGYTSIFIO-MFKUBSTISA-N |
| XLogP | 6.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|