C26H32N2O2 — CID 50868984
methyl 3-methyl-4-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzoate (PubChem CID 50868984) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is methyl 3-methyl-4-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzoate.
| Compound Name | methyl 3-methyl-4-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 50868984 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | methyl 3-methyl-4-[(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzoate |
| SMILES | CCCN1c2cc(C)c(/C=N/c3ccc(C(=O)OC)cc3C)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C26H32N2O2/c1-8-11-28-24-13-17(2)21(14-22(24)19(4)15-26(28,5)6)16-27-23-10-9-20(12-18(23)3)25(29)30-7/h9-10,12-16H,8,11H2,1-7H3/b27-16+ |
| InChIKey | WNTBCTGGEVQNKJ-JVWAILMASA-N |
| XLogP | 6.25 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|