C24H28N2O2 — CID 50866348
methyl 4-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-methylbenzoate (PubChem CID 50866348) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is methyl 4-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-methylbenzoate.
| Compound Name | methyl 4-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-methylbenzoate |
|---|---|
| PubChem CID | 50866348 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | methyl 4-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-3-methylbenzoate |
| SMILES | CCN1c2ccc(/C=N/c3ccc(C(=O)OC)cc3C)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H28N2O2/c1-7-26-22-11-8-18(13-20(22)17(3)14-24(26,4)5)15-25-21-10-9-19(12-16(21)2)23(27)28-6/h8-15H,7H2,1-6H3/b25-15+ |
| InChIKey | VEUQSBYWPNAYHS-MFKUBSTISA-N |
| XLogP | 5.55 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|