C25H30N2O2 — CID 50866924
methyl 3-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-4-methylbenzoate (PubChem CID 50866924) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is methyl 3-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-4-methylbenzoate.
| Compound Name | methyl 3-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 50866924 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | methyl 3-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-4-methylbenzoate |
| SMILES | CCN1c2cc(C)c(/C=N/c3cc(C(=O)OC)ccc3C)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C25H30N2O2/c1-8-27-23-11-17(3)20(12-21(23)18(4)14-25(27,5)6)15-26-22-13-19(24(28)29-7)10-9-16(22)2/h9-15H,8H2,1-7H3/b26-15+ |
| InChIKey | LNYIPDWALIJUKT-CVKSISIWSA-N |
| XLogP | 5.86 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|