C25H31N3O — CID 50866726
N-[(E)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-3-phenylpropanamide (PubChem CID 50866726) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is N-[(E)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-3-phenylpropanamide.
| Compound Name | N-[(E)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 50866726 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | N-[(E)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-3-phenylpropanamide |
| SMILES | CCN1c2cc(C)c(/C=N/NC(=O)CCc3ccccc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C25H31N3O/c1-6-28-23-14-18(2)21(15-22(23)19(3)16-25(28,4)5)17-26-27-24(29)13-12-20-10-8-7-9-11-20/h7-11,14-17H,6,12-13H2,1-5H3,(H,27,29)/b26-17+ |
| InChIKey | CBWKAZKRFGFKDU-YZSQISJMSA-N |
| XLogP | 5.10 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|