C24H28FN3O2 — CID 50867457
N-[(E)-(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-(3-methoxyphenyl)acetamide (PubChem CID 50867457) has the molecular formula C24H28FN3O2 and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[(E)-(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-[(E)-(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 50867457 |
| Molecular Formula | C24H28FN3O2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | N-[(E)-(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-(3-methoxyphenyl)acetamide |
| SMILES | CCN1c2cc(F)c(/C=N/NC(=O)Cc3cccc(OC)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H28FN3O2/c1-6-28-22-13-21(25)18(12-20(22)16(2)14-24(28,3)4)15-26-27-23(29)11-17-8-7-9-19(10-17)30-5/h7-10,12-15H,6,11H2,1-5H3,(H,27,29)/b26-15+ |
| InChIKey | AOPCOBNTYXBTRM-CVKSISIWSA-N |
| XLogP | 4.55 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|