C28H30FN3O — CID 50869439
N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-2-naphthalen-1-ylacetamide (PubChem CID 50869439) has the molecular formula C28H30FN3O and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 50869439 |
| Molecular Formula | C28H30FN3O |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-2-naphthalen-1-ylacetamide |
| SMILES | CCCN1c2cc(F)c(/C=N\NC(=O)Cc3cccc4ccccc34)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C28H30FN3O/c1-5-13-32-26-16-25(29)22(14-24(26)19(2)17-28(32,3)4)18-30-31-27(33)15-21-11-8-10-20-9-6-7-12-23(20)21/h6-12,14,16-18H,5,13,15H2,1-4H3,(H,31,33)/b30-18- |
| InChIKey | KOWRNJXUDKIGMX-YKQZZPSBSA-N |
| XLogP | 6.08 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|