C23H24Br2FN3O2 — CID 50869480
3,5-dibromo-N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-4-hydroxybenzamide (PubChem CID 50869480) has the molecular formula C23H24Br2FN3O2 and a molecular weight of 553.27 g/mol. Its IUPAC name is 3,5-dibromo-N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3,5-dibromo-N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 50869480 |
| Molecular Formula | C23H24Br2FN3O2 |
| Molecular Weight | 553.27 g/mol |
| Exact Mass | 551.02 |
| IUPAC Name | 3,5-dibromo-N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-4-hydroxybenzamide |
| SMILES | CCCN1c2cc(F)c(/C=N\NC(=O)c3cc(Br)c(O)c(Br)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H24Br2FN3O2/c1-5-6-29-20-10-19(26)15(7-16(20)13(2)11-23(29,3)4)12-27-28-22(31)14-8-17(24)21(30)18(25)9-14/h7-12,30H,5-6H2,1-4H3,(H,28,31)/b27-12- |
| InChIKey | AHNAYVYOFIQNET-PPDIBHTLSA-N |
| XLogP | 6.23 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.27 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|