C24H27ClFN3O — CID 50869426
2-chloro-N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-4-methylbenzamide (PubChem CID 50869426) has the molecular formula C24H27ClFN3O and a molecular weight of 427.95 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 50869426 |
| Molecular Formula | C24H27ClFN3O |
| Molecular Weight | 427.95 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-chloro-N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-4-methylbenzamide |
| SMILES | CCCN1c2cc(F)c(/C=N\NC(=O)c3ccc(C)cc3Cl)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H27ClFN3O/c1-6-9-29-22-12-21(26)17(11-19(22)16(3)13-24(29,4)5)14-27-28-23(30)18-8-7-15(2)10-20(18)25/h7-8,10-14H,6,9H2,1-5H3,(H,28,30)/b27-14- |
| InChIKey | YFGMWYVMMLVWEA-VYYCAZPPSA-N |
| XLogP | 5.96 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.95 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|