C27H29ClN4O — CID 50868872
N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-2-pyrrol-1-ylbenzamide (PubChem CID 50868872) has the molecular formula C27H29ClN4O and a molecular weight of 461.01 g/mol. Its IUPAC name is N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-2-pyrrol-1-ylbenzamide.
| Compound Name | N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-2-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 50868872 |
| Molecular Formula | C27H29ClN4O |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-2-pyrrol-1-ylbenzamide |
| SMILES | CCCN1c2cc(Cl)c(/C=N\NC(=O)c3ccccc3-n3cccc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C27H29ClN4O/c1-5-12-32-25-16-23(28)20(15-22(25)19(2)17-27(32,3)4)18-29-30-26(33)21-10-6-7-11-24(21)31-13-8-9-14-31/h6-11,13-18H,5,12H2,1-4H3,(H,30,33)/b29-18- |
| InChIKey | ZUSCWVDKGHIONF-MIXAMLLLSA-N |
| XLogP | 6.31 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|