C26H33N3O2 — CID 50868728
2-methoxy-4-methyl-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50868728) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-methoxy-4-methyl-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 2-methoxy-4-methyl-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50868728 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 2-methoxy-4-methyl-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CCCN1c2cc(C)c(/C=N\NC(=O)c3ccc(C)cc3OC)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C26H33N3O2/c1-8-11-29-23-13-18(3)20(14-22(23)19(4)15-26(29,5)6)16-27-28-25(30)21-10-9-17(2)12-24(21)31-7/h9-10,12-16H,8,11H2,1-7H3,(H,28,30)/b27-16- |
| InChIKey | RBQDCOABEAOTIP-YUMHPJSZSA-N |
| XLogP | 5.49 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|