C25H32N4O2 — CID 50868604
1-(2-methoxyphenyl)-3-[(E)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]urea (PubChem CID 50868604) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[(E)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[(E)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 50868604 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[(E)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]urea |
| SMILES | CCCN1c2cc(C)c(/C=N/NC(=O)Nc3ccccc3OC)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C25H32N4O2/c1-7-12-29-22-13-17(2)19(14-20(22)18(3)15-25(29,4)5)16-26-28-24(30)27-21-10-8-9-11-23(21)31-6/h8-11,13-16H,7,12H2,1-6H3,(H2,27,28,30)/b26-16+ |
| InChIKey | PVRHORDTAGUTOT-WGOQTCKBSA-N |
| XLogP | 5.57 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|