C25H30IN3O2 — CID 50868466
4-iodo-3-methoxy-N-[(E)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50868466) has the molecular formula C25H30IN3O2 and a molecular weight of 531.44 g/mol. Its IUPAC name is 4-iodo-3-methoxy-N-[(E)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 4-iodo-3-methoxy-N-[(E)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50868466 |
| Molecular Formula | C25H30IN3O2 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 4-iodo-3-methoxy-N-[(E)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CCCN1c2cc(C)c(/C=N/NC(=O)c3ccc(I)c(OC)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C25H30IN3O2/c1-7-10-29-22-11-16(2)19(12-20(22)17(3)14-25(29,4)5)15-27-28-24(30)18-8-9-21(26)23(13-18)31-6/h8-9,11-15H,7,10H2,1-6H3,(H,28,30)/b27-15+ |
| InChIKey | JOYLTNRVIKLLAZ-JFLMPSFJSA-N |
| XLogP | 5.78 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|