C22H23Cl2N3O — CID 133170003
3,4-dichloro-N-[(E)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]benzamide (PubChem CID 133170003) has the molecular formula C22H23Cl2N3O and a molecular weight of 416.35 g/mol. Its IUPAC name is 3,4-dichloro-N-[(E)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 3,4-dichloro-N-[(E)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 133170003 |
| Molecular Formula | C22H23Cl2N3O |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 3,4-dichloro-N-[(E)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CC1=CC(C)(C)N(C)c2cc(C)c(/C=N/NC(=O)c3ccc(Cl)c(Cl)c3)cc21 |
| InChI | InChI=1S/C22H23Cl2N3O/c1-13-8-20-17(14(2)11-22(3,4)27(20)5)9-16(13)12-25-26-21(28)15-6-7-18(23)19(24)10-15/h6-12H,1-5H3,(H,26,28)/b25-12+ |
| InChIKey | QIPCGAYMERLNRD-BRJLIKDPSA-N |
| XLogP | 5.70 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|