C22H21F4N3O — CID 50865573
N-[(Z)-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]-3-(trifluoromethyl)benzamide (PubChem CID 50865573) has the molecular formula C22H21F4N3O and a molecular weight of 419.42 g/mol. Its IUPAC name is N-[(Z)-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(Z)-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 50865573 |
| Molecular Formula | C22H21F4N3O |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-[(Z)-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]-3-(trifluoromethyl)benzamide |
| SMILES | CC1=CC(C)(C)N(C)c2cc(F)c(/C=N\NC(=O)c3cccc(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C22H21F4N3O/c1-13-11-21(2,3)29(4)19-10-18(23)15(9-17(13)19)12-27-28-20(30)14-6-5-7-16(8-14)22(24,25)26/h5-12H,1-4H3,(H,28,30)/b27-12- |
| InChIKey | IDKZVKWESIYOOS-PPDIBHTLSA-N |
| XLogP | 5.24 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|