C23H26FN3O2 — CID 50869212
N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-4-hydroxybenzamide (PubChem CID 50869212) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-4-hydroxybenzamide.
| Compound Name | N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 50869212 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-[(Z)-(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-4-hydroxybenzamide |
| SMILES | CCCN1c2cc(F)c(/C=N\NC(=O)c3ccc(O)cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H26FN3O2/c1-5-10-27-21-12-20(24)17(11-19(21)15(2)13-23(27,3)4)14-25-26-22(29)16-6-8-18(28)9-7-16/h6-9,11-14,28H,5,10H2,1-4H3,(H,26,29)/b25-14- |
| InChIKey | ABOJGFUFANNKTB-QFEZKATASA-N |
| XLogP | 4.71 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|