C27H28ClN3O — CID 50868948
N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]naphthalene-2-carboxamide (PubChem CID 50868948) has the molecular formula C27H28ClN3O and a molecular weight of 445.99 g/mol. Its IUPAC name is N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]naphthalene-2-carboxamide.
| Compound Name | N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 50868948 |
| Molecular Formula | C27H28ClN3O |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]naphthalene-2-carboxamide |
| SMILES | CCCN1c2cc(Cl)c(/C=N\NC(=O)c3ccc4ccccc4c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C27H28ClN3O/c1-5-12-31-25-15-24(28)22(14-23(25)18(2)16-27(31,3)4)17-29-30-26(32)21-11-10-19-8-6-7-9-20(19)13-21/h6-11,13-17H,5,12H2,1-4H3,(H,30,32)/b29-17- |
| InChIKey | ITHFMXSPWSYCOV-RHANQZHGSA-N |
| XLogP | 6.67 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|