C28H31N3O2 — CID 50868530
3-hydroxy-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]naphthalene-2-carboxamide (PubChem CID 50868530) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 3-hydroxy-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]naphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 50868530 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 3-hydroxy-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]naphthalene-2-carboxamide |
| SMILES | CCCN1c2cc(C)c(/C=N\NC(=O)c3cc4ccccc4cc3O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C28H31N3O2/c1-6-11-31-25-12-18(2)22(14-23(25)19(3)16-28(31,4)5)17-29-30-27(33)24-13-20-9-7-8-10-21(20)15-26(24)32/h7-10,12-17,32H,6,11H2,1-5H3,(H,30,33)/b29-17- |
| InChIKey | OFEMAEIOHHMNHE-RHANQZHGSA-N |
| XLogP | 6.03 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|